C13H9Cl2NO4S — CID 107167083
2-thiophen-2-ylethyl 2,3-dichloro-5-nitrobenzoate (PubChem CID 107167083) has the molecular formula C13H9Cl2NO4S and a molecular weight of 346.19 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2,3-dichloro-5-nitrobenzoate.
| Compound Name | 2-thiophen-2-ylethyl 2,3-dichloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 107167083 |
| Molecular Formula | C13H9Cl2NO4S |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 344.96 |
| IUPAC Name | 2-thiophen-2-ylethyl 2,3-dichloro-5-nitrobenzoate |
| SMILES | O=C(OCCc1cccs1)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2NO4S/c14-11-7-8(16(18)19)6-10(12(11)15)13(17)20-4-3-9-2-1-5-21-9/h1-2,5-7H,3-4H2 |
| InChIKey | RNTXSRHBONWESP-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|