C9H6Cl2N2O6 — CID 107186409
2-[(2,3-dichloro-5-nitrobenzoyl)amino]oxyacetic acid (PubChem CID 107186409) has the molecular formula C9H6Cl2N2O6 and a molecular weight of 309.06 g/mol. Its IUPAC name is 2-[(2,3-dichloro-5-nitrobenzoyl)amino]oxyacetic acid.
| Compound Name | 2-[(2,3-dichloro-5-nitrobenzoyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 107186409 |
| Molecular Formula | C9H6Cl2N2O6 |
| Molecular Weight | 309.06 g/mol |
| Exact Mass | 307.96 |
| IUPAC Name | 2-[(2,3-dichloro-5-nitrobenzoyl)amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C9H6Cl2N2O6/c10-6-2-4(13(17)18)1-5(8(6)11)9(16)12-19-3-7(14)15/h1-2H,3H2,(H,12,16)(H,14,15) |
| InChIKey | IKNPTNVYHUFRMA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.06 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|