C13H15Cl2NO5 — CID 107167069
(3-methoxy-3-methylbutyl) 2,3-dichloro-5-nitrobenzoate (PubChem CID 107167069) has the molecular formula C13H15Cl2NO5 and a molecular weight of 336.17 g/mol. Its IUPAC name is (3-methoxy-3-methylbutyl) 2,3-dichloro-5-nitrobenzoate.
| Compound Name | (3-methoxy-3-methylbutyl) 2,3-dichloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 107167069 |
| Molecular Formula | C13H15Cl2NO5 |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | (3-methoxy-3-methylbutyl) 2,3-dichloro-5-nitrobenzoate |
| SMILES | COC(C)(C)CCOC(=O)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C13H15Cl2NO5/c1-13(2,20-3)4-5-21-12(17)9-6-8(16(18)19)7-10(14)11(9)15/h6-7H,4-5H2,1-3H3 |
| InChIKey | ITKMZUWMPFJJEV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|