C11H10Cl2N2O4 — CID 58937932
methyl N-[2-(2,3-dichloro-5-nitrophenyl)prop-2-enyl]carbamate (PubChem CID 58937932) has the molecular formula C11H10Cl2N2O4 and a molecular weight of 305.12 g/mol. Its IUPAC name is methyl N-[2-(2,3-dichloro-5-nitrophenyl)prop-2-enyl]carbamate.
| Compound Name | methyl N-[2-(2,3-dichloro-5-nitrophenyl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 58937932 |
| Molecular Formula | C11H10Cl2N2O4 |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | methyl N-[2-(2,3-dichloro-5-nitrophenyl)prop-2-enyl]carbamate |
| SMILES | C=C(CNC(=O)OC)c1cc([N+](=O)[O-])cc(Cl)c1Cl |
| InChI | InChI=1S/C11H10Cl2N2O4/c1-6(5-14-11(16)19-2)8-3-7(15(17)18)4-9(12)10(8)13/h3-4H,1,5H2,2H3,(H,14,16) |
| InChIKey | FFEFYPGVNJUILK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|