C23H26N2O7S — CID 55492493
3-(1,3-dioxoisoindol-2-yl)propyl 3-(tert-butylsulfamoyl)-4-methoxybenzoate (PubChem CID 55492493) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl 3-(tert-butylsulfamoyl)-4-methoxybenzoate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
|---|---|
| PubChem CID | 55492493 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl 3-(tert-butylsulfamoyl)-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCCN2C(=O)c3ccccc3C2=O)cc1S(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C23H26N2O7S/c1-23(2,3)24-33(29,30)19-14-15(10-11-18(19)31-4)22(28)32-13-7-12-25-20(26)16-8-5-6-9-17(16)21(25)27/h5-6,8-11,14,24H,7,12-13H2,1-4H3 |
| InChIKey | QKQQNXCZKLKEFW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|