C22H23NO6 — CID 7194690
2-(1,3-dioxoisoindol-2-yl)ethyl 3-methoxy-4-(2-methylpropoxy)benzoate (PubChem CID 7194690) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 3-methoxy-4-(2-methylpropoxy)benzoate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3-methoxy-4-(2-methylpropoxy)benzoate |
|---|---|
| PubChem CID | 7194690 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 3-methoxy-4-(2-methylpropoxy)benzoate |
| SMILES | COc1cc(C(=O)OCCN2C(=O)c3ccccc3C2=O)ccc1OCC(C)C |
| InChI | InChI=1S/C22H23NO6/c1-14(2)13-29-18-9-8-15(12-19(18)27-3)22(26)28-11-10-23-20(24)16-6-4-5-7-17(16)21(23)25/h4-9,12,14H,10-11,13H2,1-3H3 |
| InChIKey | BOQUECPQJZUZNS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|