C19H22N2O5S — CID 27174310
3-(cyclopropylsulfamoyl)-N-[2-(4-methoxyphenoxy)ethyl]benzamide (PubChem CID 27174310) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is 3-(cyclopropylsulfamoyl)-N-[2-(4-methoxyphenoxy)ethyl]benzamide.
| Compound Name | 3-(cyclopropylsulfamoyl)-N-[2-(4-methoxyphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 27174310 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 3-(cyclopropylsulfamoyl)-N-[2-(4-methoxyphenoxy)ethyl]benzamide |
| SMILES | COc1ccc(OCCNC(=O)c2cccc(S(=O)(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-25-16-7-9-17(10-8-16)26-12-11-20-19(22)14-3-2-4-18(13-14)27(23,24)21-15-5-6-15/h2-4,7-10,13,15,21H,5-6,11-12H2,1H3,(H,20,22) |
| InChIKey | LDKGGOAEJMBFSL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|