C19H19BrN2O5S — CID 46809010
[2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 46809010) has the molecular formula C19H19BrN2O5S and a molecular weight of 467.34 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46809010 |
| Molecular Formula | C19H19BrN2O5S |
| Molecular Weight | 467.34 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | Cc1cc(Br)ccc1NC(=O)COC(=O)c1cccc(S(=O)(=O)NC2CC2)c1 |
| InChI | InChI=1S/C19H19BrN2O5S/c1-12-9-14(20)5-8-17(12)21-18(23)11-27-19(24)13-3-2-4-16(10-13)28(25,26)22-15-6-7-15/h2-5,8-10,15,22H,6-7,11H2,1H3,(H,21,23) |
| InChIKey | VFGYJVUEAIOCCK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |