C16H14BrNO4 — CID 2628190
[2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-hydroxybenzoate (PubChem CID 2628190) has the molecular formula C16H14BrNO4 and a molecular weight of 364.20 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-hydroxybenzoate.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-hydroxybenzoate |
|---|---|
| PubChem CID | 2628190 |
| Molecular Formula | C16H14BrNO4 |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl] 3-hydroxybenzoate |
| SMILES | Cc1cc(Br)ccc1NC(=O)COC(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C16H14BrNO4/c1-10-7-12(17)5-6-14(10)18-15(20)9-22-16(21)11-3-2-4-13(19)8-11/h2-8,19H,9H2,1H3,(H,18,20) |
| InChIKey | DNLGLZPHLVZJDU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |