C22H26N2O5S — CID 55369094
[2-oxo-2-(1-phenylbutylamino)ethyl] 3-(cyclopropylsulfamoyl)benzoate (PubChem CID 55369094) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylbutylamino)ethyl] 3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(1-phenylbutylamino)ethyl] 3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55369094 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | [2-oxo-2-(1-phenylbutylamino)ethyl] 3-(cyclopropylsulfamoyl)benzoate |
| SMILES | CCCC(NC(=O)COC(=O)c1cccc(S(=O)(=O)NC2CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-2-7-20(16-8-4-3-5-9-16)23-21(25)15-29-22(26)17-10-6-11-19(14-17)30(27,28)24-18-12-13-18/h3-6,8-11,14,18,20,24H,2,7,12-13,15H2,1H3,(H,23,25) |
| InChIKey | CTKMCTODFRTUPK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |