C16H24N2O5S — CID 42900495
[2-oxo-2-(pentan-2-ylamino)ethyl] 3-(ethylsulfamoyl)benzoate (PubChem CID 42900495) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 3-(ethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42900495 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 3-(ethylsulfamoyl)benzoate |
| SMILES | CCCC(C)NC(=O)COC(=O)c1cccc(S(=O)(=O)NCC)c1 |
| InChI | InChI=1S/C16H24N2O5S/c1-4-7-12(3)18-15(19)11-23-16(20)13-8-6-9-14(10-13)24(21,22)17-5-2/h6,8-10,12,17H,4-5,7,11H2,1-3H3,(H,18,19) |
| InChIKey | UURGWHWTGUSFMM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |