C19H24N2O6S — CID 7976486
[2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 7976486) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7976486 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | [2-oxo-2-[[(2R)-pentan-2-yl]amino]ethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CCC[C@@H](C)NC(=O)COC(=O)c1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C19H24N2O6S/c1-3-6-14(2)21-18(22)13-27-19(23)15-7-4-9-17(11-15)28(24,25)20-12-16-8-5-10-26-16/h4-5,7-11,14,20H,3,6,12-13H2,1-2H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | GSUKZPYAQQKMNL-CQSZACIVSA-N |
| XLogP | 2.22 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |