C18H20N2O6S — CID 7976489
[(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 7976489) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7976489 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | [(2S)-1-(cyclopropylamino)-1-oxopropan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(S(=O)(=O)NCc2ccco2)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C18H20N2O6S/c1-12(17(21)20-14-7-8-14)26-18(22)13-4-2-6-16(10-13)27(23,24)19-11-15-5-3-9-25-15/h2-6,9-10,12,14,19H,7-8,11H2,1H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | IPALXZWQWLEJEC-LBPRGKRZSA-N |
| XLogP | 1.58 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |