C22H21N3O7S — CID 46668074
[1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 46668074) has the molecular formula C22H21N3O7S and a molecular weight of 471.49 g/mol. Its IUPAC name is [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46668074 |
| Molecular Formula | C22H21N3O7S |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CC(OC(=O)c1cccc(S(=O)(=O)NCc2ccco2)c1)C(=O)NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H21N3O7S/c1-15(20(26)25-22(28)24-17-8-3-2-4-9-17)32-21(27)16-7-5-11-19(13-16)33(29,30)23-14-18-10-6-12-31-18/h2-13,15,23H,14H2,1H3,(H2,24,25,26,28) |
| InChIKey | MMZAWLHLWVNKNA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |