C25H25N3O6S — CID 46668615
[1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 46668615) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 46668615 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [1-oxo-1-(phenylcarbamoylamino)propan-2-yl] 3-[methyl-(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2cccc(C(=O)OC(C)C(=O)NC(=O)Nc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H25N3O6S/c1-17-12-14-21(15-13-17)28(3)35(32,33)22-11-7-8-19(16-22)24(30)34-18(2)23(29)27-25(31)26-20-9-5-4-6-10-20/h4-16,18H,1-3H3,(H2,26,27,29,31) |
| InChIKey | QNNMWKXMBCEAOZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |