C24H26N2O6S — CID 42987157
[2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 42987157) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is [2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 42987157 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [2-[1-(4-ethylphenyl)ethylamino]-2-oxoethyl] 3-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CCc1ccc(C(C)NC(=O)COC(=O)c2cccc(S(=O)(=O)NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C24H26N2O6S/c1-3-18-9-11-19(12-10-18)17(2)26-23(27)16-32-24(28)20-6-4-8-22(14-20)33(29,30)25-15-21-7-5-13-31-21/h4-14,17,25H,3,15-16H2,1-2H3,(H,26,27) |
| InChIKey | PMXLMERNRRDZHU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |