C18H22N2O3 — CID 18199730
[2-oxo-2-(pentan-2-ylamino)ethyl] 3-pyrrol-1-ylbenzoate (PubChem CID 18199730) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] 3-pyrrol-1-ylbenzoate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 3-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 18199730 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] 3-pyrrol-1-ylbenzoate |
| SMILES | CCCC(C)NC(=O)COC(=O)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-3-7-14(2)19-17(21)13-23-18(22)15-8-6-9-16(12-15)20-10-4-5-11-20/h4-6,8-12,14H,3,7,13H2,1-2H3,(H,19,21) |
| InChIKey | LVHKESUZPHNIDU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |