C22H22N2O3 — CID 40689647
[2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-pyrrol-1-ylbenzoate (PubChem CID 40689647) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is [2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-pyrrol-1-ylbenzoate.
| Compound Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 40689647 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [2-oxo-2-(2-propan-2-ylanilino)ethyl] 3-pyrrol-1-ylbenzoate |
| SMILES | CC(C)c1ccccc1NC(=O)COC(=O)c1cccc(-n2cccc2)c1 |
| InChI | InChI=1S/C22H22N2O3/c1-16(2)19-10-3-4-11-20(19)23-21(25)15-27-22(26)17-8-7-9-18(14-17)24-12-5-6-13-24/h3-14,16H,15H2,1-2H3,(H,23,25) |
| InChIKey | DYBIXJFCLYZWTK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |