C22H20N2O3 — CID 18276004
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 3-pyrrol-1-ylbenzoate (PubChem CID 18276004) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 3-pyrrol-1-ylbenzoate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 3-pyrrol-1-ylbenzoate |
|---|---|
| PubChem CID | 18276004 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 3-pyrrol-1-ylbenzoate |
| SMILES | O=C(COC(=O)c1cccc(-n2cccc2)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H20N2O3/c25-21(23-19-10-9-16-5-3-6-17(16)13-19)15-27-22(26)18-7-4-8-20(14-18)24-11-1-2-12-24/h1-2,4,7-14H,3,5-6,15H2,(H,23,25) |
| InChIKey | XORRVTAAESBASP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |