C19H21ClN2O3 — CID 7594617
[2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 3-amino-4-chlorobenzoate (PubChem CID 7594617) has the molecular formula C19H21ClN2O3 and a molecular weight of 360.84 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7594617 |
| Molecular Formula | C19H21ClN2O3 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylbutyl]amino]ethyl] 3-amino-4-chlorobenzoate |
| SMILES | CCC[C@@H](NC(=O)COC(=O)c1ccc(Cl)c(N)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21ClN2O3/c1-2-6-17(13-7-4-3-5-8-13)22-18(23)12-25-19(24)14-9-10-15(20)16(21)11-14/h3-5,7-11,17H,2,6,12,21H2,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | QULPRQNUAPSLQN-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|