C21H24ClNO5 — CID 55366060
[2-oxo-2-(1-phenylbutylamino)ethyl] 3-chloro-4,5-dimethoxybenzoate (PubChem CID 55366060) has the molecular formula C21H24ClNO5 and a molecular weight of 405.88 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylbutylamino)ethyl] 3-chloro-4,5-dimethoxybenzoate.
| Compound Name | [2-oxo-2-(1-phenylbutylamino)ethyl] 3-chloro-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 55366060 |
| Molecular Formula | C21H24ClNO5 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | [2-oxo-2-(1-phenylbutylamino)ethyl] 3-chloro-4,5-dimethoxybenzoate |
| SMILES | CCCC(NC(=O)COC(=O)c1cc(Cl)c(OC)c(OC)c1)c1ccccc1 |
| InChI | InChI=1S/C21H24ClNO5/c1-4-8-17(14-9-6-5-7-10-14)23-19(24)13-28-21(25)15-11-16(22)20(27-3)18(12-15)26-2/h5-7,9-12,17H,4,8,13H2,1-3H3,(H,23,24) |
| InChIKey | JRZUUCBBAKTQLF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |