C17H19NO4S — CID 4310062
(2,6-dimethylphenyl) 4-(dimethylsulfamoyl)benzoate (PubChem CID 4310062) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 4-(dimethylsulfamoyl)benzoate.
| Compound Name | (2,6-dimethylphenyl) 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 4310062 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (2,6-dimethylphenyl) 4-(dimethylsulfamoyl)benzoate |
| SMILES | Cc1cccc(C)c1OC(=O)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H19NO4S/c1-12-6-5-7-13(2)16(12)22-17(19)14-8-10-15(11-9-14)23(20,21)18(3)4/h5-11H,1-4H3 |
| InChIKey | UHLASFGWHGXJTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|