C16H16ClNO4S — CID 7994009
(2,5-dimethylphenyl)methyl 2-chloro-5-sulfamoylbenzoate (PubChem CID 7994009) has the molecular formula C16H16ClNO4S and a molecular weight of 353.83 g/mol. Its IUPAC name is (2,5-dimethylphenyl)methyl 2-chloro-5-sulfamoylbenzoate.
| Compound Name | (2,5-dimethylphenyl)methyl 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 7994009 |
| Molecular Formula | C16H16ClNO4S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | (2,5-dimethylphenyl)methyl 2-chloro-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(C)c(COC(=O)c2cc(S(N)(=O)=O)ccc2Cl)c1 |
| InChI | InChI=1S/C16H16ClNO4S/c1-10-3-4-11(2)12(7-10)9-22-16(19)14-8-13(23(18,20)21)5-6-15(14)17/h3-8H,9H2,1-2H3,(H2,18,20,21) |
| InChIKey | MDYXVUWLCFXWPP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |