C23H20ClNO5S — CID 42985997
[1,2-bis(4-methylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 42985997) has the molecular formula C23H20ClNO5S and a molecular weight of 457.94 g/mol. Its IUPAC name is [1,2-bis(4-methylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42985997 |
| Molecular Formula | C23H20ClNO5S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | Cc1ccc(C(=O)C(OC(=O)c2cc(S(N)(=O)=O)ccc2Cl)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H20ClNO5S/c1-14-3-7-16(8-4-14)21(26)22(17-9-5-15(2)6-10-17)30-23(27)19-13-18(31(25,28)29)11-12-20(19)24/h3-13,22H,1-2H3,(H2,25,28,29) |
| InChIKey | RMOLPDGBOLTIJM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |