C21H16ClNO5S — CID 42985828
(2-oxo-1,2-diphenylethyl) 2-chloro-5-sulfamoylbenzoate (PubChem CID 42985828) has the molecular formula C21H16ClNO5S and a molecular weight of 429.88 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 2-chloro-5-sulfamoylbenzoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 42985828 |
| Molecular Formula | C21H16ClNO5S |
| Molecular Weight | 429.88 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 2-chloro-5-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(C(=O)OC(C(=O)c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C21H16ClNO5S/c22-18-12-11-16(29(23,26)27)13-17(18)21(25)28-20(15-9-5-2-6-10-15)19(24)14-7-3-1-4-8-14/h1-13,20H,(H2,23,26,27) |
| InChIKey | LPWHEIHBYRSHCT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.88 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |