C17H17FN2O5S — CID 8638579
[(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-fluoro-5-sulfamoylbenzoate (PubChem CID 8638579) has the molecular formula C17H17FN2O5S and a molecular weight of 380.40 g/mol. Its IUPAC name is [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-fluoro-5-sulfamoylbenzoate.
| Compound Name | [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-fluoro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 8638579 |
| Molecular Formula | C17H17FN2O5S |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [(1S)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-fluoro-5-sulfamoylbenzoate |
| SMILES | CN(C)C(=O)[C@@H](OC(=O)c1cc(S(N)(=O)=O)ccc1F)c1ccccc1 |
| InChI | InChI=1S/C17H17FN2O5S/c1-20(2)16(21)15(11-6-4-3-5-7-11)25-17(22)13-10-12(26(19,23)24)8-9-14(13)18/h3-10,15H,1-2H3,(H2,19,23,24)/t15-/m0/s1 |
| InChIKey | IXARLWVLGXJOFX-HNNXBMFYSA-N |
| XLogP | 1.46 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |