C22H17ClFNO5S — CID 16517612
[2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 16517612) has the molecular formula C22H17ClFNO5S and a molecular weight of 461.90 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 16517612 |
| Molecular Formula | C22H17ClFNO5S |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)OC(C(=O)Nc2ccc(F)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H17ClFNO5S/c1-31(28,29)17-11-12-19(23)18(13-17)22(27)30-20(14-5-3-2-4-6-14)21(26)25-16-9-7-15(24)8-10-16/h2-13,20H,1H3,(H,25,26) |
| InChIKey | HYSXAYSWFGCWAC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |