C22H19FN2O5S — CID 2646873
[(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 2646873) has the molecular formula C22H19FN2O5S and a molecular weight of 442.47 g/mol. Its IUPAC name is [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2646873 |
| Molecular Formula | C22H19FN2O5S |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | [(1S)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)O[C@H](C(=O)Nc2ccc(F)cc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H19FN2O5S/c1-24-31(28,29)19-9-5-8-16(14-19)22(27)30-20(15-6-3-2-4-7-15)21(26)25-18-12-10-17(23)11-13-18/h2-14,20,24H,1H3,(H,25,26)/t20-/m0/s1 |
| InChIKey | FMDLDPBJJBDRKV-FQEVSTJZSA-N |
| XLogP | 3.27 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |