C19H18ClNO5S — CID 8603248
[(1S)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 8603248) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is [(1S)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [(1S)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 8603248 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | [(1S)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)O[C@H](C(=O)NC2CC2)c2ccccc2)c1 |
| InChI | InChI=1S/C19H18ClNO5S/c1-27(24,25)14-9-10-16(20)15(11-14)19(23)26-17(12-5-3-2-4-6-12)18(22)21-13-7-8-13/h2-6,9-11,13,17H,7-8H2,1H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | YFLSYJTVCUTICB-KRWDZBQOSA-N |
| XLogP | 2.92 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |