C16H14ClNO5S — CID 51530614
[(1R)-2-amino-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate (PubChem CID 51530614) has the molecular formula C16H14ClNO5S and a molecular weight of 367.81 g/mol. Its IUPAC name is [(1R)-2-amino-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate.
| Compound Name | [(1R)-2-amino-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 51530614 |
| Molecular Formula | C16H14ClNO5S |
| Molecular Weight | 367.81 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | [(1R)-2-amino-2-oxo-1-phenylethyl] 2-chloro-5-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1ccc(Cl)c(C(=O)O[C@@H](C(N)=O)c2ccccc2)c1 |
| InChI | InChI=1S/C16H14ClNO5S/c1-24(21,22)11-7-8-13(17)12(9-11)16(20)23-14(15(18)19)10-5-3-2-4-6-10/h2-9,14H,1H3,(H2,18,19)/t14-/m1/s1 |
| InChIKey | BAJJZBCBRRXYTI-CQSZACIVSA-N |
| XLogP | 2.13 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.81 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |