C15H12ClNO4 — CID 18138363
(2-amino-2-oxo-1-phenylethyl) 4-chloro-2-hydroxybenzoate (PubChem CID 18138363) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is (2-amino-2-oxo-1-phenylethyl) 4-chloro-2-hydroxybenzoate.
| Compound Name | (2-amino-2-oxo-1-phenylethyl) 4-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 18138363 |
| Molecular Formula | C15H12ClNO4 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (2-amino-2-oxo-1-phenylethyl) 4-chloro-2-hydroxybenzoate |
| SMILES | NC(=O)C(OC(=O)c1ccc(Cl)cc1O)c1ccccc1 |
| InChI | InChI=1S/C15H12ClNO4/c16-10-6-7-11(12(18)8-10)15(20)21-13(14(17)19)9-4-2-1-3-5-9/h1-8,13,18H,(H2,17,19) |
| InChIKey | QAYNAWGSUTZPAU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |