C25H24O3 — CID 7793941
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3,4-dimethylbenzoate (PubChem CID 7793941) has the molecular formula C25H24O3 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3,4-dimethylbenzoate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3,4-dimethylbenzoate |
|---|---|
| PubChem CID | 7793941 |
| Molecular Formula | C25H24O3 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3,4-dimethylbenzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](OC(=O)c2ccc(C)c(C)c2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H24O3/c1-16-5-10-20(11-6-16)23(26)24(21-12-7-17(2)8-13-21)28-25(27)22-14-9-18(3)19(4)15-22/h5-15,24H,1-4H3/t24-/m0/s1 |
| InChIKey | DALDIEQRXCWCHL-DEOSSOPVSA-N |
| XLogP | 5.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |