C24H23NO5S — CID 4830617
[1,2-bis(4-methylphenyl)-2-oxoethyl] 3-(methanesulfonamido)benzoate (PubChem CID 4830617) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is [1,2-bis(4-methylphenyl)-2-oxoethyl] 3-(methanesulfonamido)benzoate.
| Compound Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] 3-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 4830617 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] 3-(methanesulfonamido)benzoate |
| SMILES | Cc1ccc(C(=O)C(OC(=O)c2cccc(NS(C)(=O)=O)c2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23NO5S/c1-16-7-11-18(12-8-16)22(26)23(19-13-9-17(2)10-14-19)30-24(27)20-5-4-6-21(15-20)25-31(3,28)29/h4-15,23,25H,1-3H3 |
| InChIKey | PQLDIAQNANTQEF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |