C23H19IO3 — CID 2409688
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3-iodobenzoate (PubChem CID 2409688) has the molecular formula C23H19IO3 and a molecular weight of 470.31 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3-iodobenzoate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3-iodobenzoate |
|---|---|
| PubChem CID | 2409688 |
| Molecular Formula | C23H19IO3 |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 3-iodobenzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](OC(=O)c2cccc(I)c2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H19IO3/c1-15-6-10-17(11-7-15)21(25)22(18-12-8-16(2)9-13-18)27-23(26)19-4-3-5-20(24)14-19/h3-14,22H,1-2H3/t22-/m0/s1 |
| InChIKey | RXKWJUVBPKHICO-QFIPXVFZSA-N |
| XLogP | 5.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|