C24H19F3O3 — CID 7859860
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-(trifluoromethyl)benzoate (PubChem CID 7859860) has the molecular formula C24H19F3O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7859860 |
| Molecular Formula | C24H19F3O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 4-(trifluoromethyl)benzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](OC(=O)c2ccc(C(F)(F)F)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H19F3O3/c1-15-3-7-17(8-4-15)21(28)22(18-9-5-16(2)6-10-18)30-23(29)19-11-13-20(14-12-19)24(25,26)27/h3-14,22H,1-2H3/t22-/m0/s1 |
| InChIKey | XHIKXDSJOXGXFP-QFIPXVFZSA-N |
| XLogP | 6.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |