C23H18F2O3 — CID 7725581
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2,6-difluorobenzoate (PubChem CID 7725581) has the molecular formula C23H18F2O3 and a molecular weight of 380.39 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2,6-difluorobenzoate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2,6-difluorobenzoate |
|---|---|
| PubChem CID | 7725581 |
| Molecular Formula | C23H18F2O3 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2,6-difluorobenzoate |
| SMILES | Cc1ccc(C(=O)[C@@H](OC(=O)c2c(F)cccc2F)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H18F2O3/c1-14-6-10-16(11-7-14)21(26)22(17-12-8-15(2)9-13-17)28-23(27)20-18(24)4-3-5-19(20)25/h3-13,22H,1-2H3/t22-/m0/s1 |
| InChIKey | HWIIQQYFLZVKOK-QFIPXVFZSA-N |
| XLogP | 5.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |