C22H19NO4 — CID 7833877
[(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 7833877) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7833877 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [(1R)-1,2-bis(4-methylphenyl)-2-oxoethyl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | Cc1ccc(C(=O)[C@H](OC(=O)c2cc[n+]([O-])cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H19NO4/c1-15-3-7-17(8-4-15)20(24)21(18-9-5-16(2)6-10-18)27-22(25)19-11-13-23(26)14-12-19/h3-14,21H,1-2H3/t21-/m1/s1 |
| InChIKey | MBUGQBKCZOQURD-OAQYLSRUSA-N |
| XLogP | 3.72 |
| TPSA | 70.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|