C29H23NO4 — CID 126189341
[(1R)-2-oxo-1,2-diphenylethyl] 4-[(4-methylbenzoyl)amino]benzoate (PubChem CID 126189341) has the molecular formula C29H23NO4 and a molecular weight of 449.51 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] 4-[(4-methylbenzoyl)amino]benzoate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] 4-[(4-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 126189341 |
| Molecular Formula | C29H23NO4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] 4-[(4-methylbenzoyl)amino]benzoate |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)O[C@@H](C(=O)c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H23NO4/c1-20-12-14-23(15-13-20)28(32)30-25-18-16-24(17-19-25)29(33)34-27(22-10-6-3-7-11-22)26(31)21-8-4-2-5-9-21/h2-19,27H,1H3,(H,30,32)/t27-/m1/s1 |
| InChIKey | RABJMLDALZYKNZ-HHHXNRCGSA-N |
| XLogP | 6.03 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |