C26H24N2O4 — CID 55320838
[2-(4-methylanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate (PubChem CID 55320838) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [2-(4-methylanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate.
| Compound Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 55320838 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [2-(4-methylanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate |
| SMILES | Cc1ccc(NC(=O)C(OC(=O)c2ccc(NC(=O)C3CC3)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O4/c1-17-7-13-21(14-8-17)28-25(30)23(18-5-3-2-4-6-18)32-26(31)20-11-15-22(16-12-20)27-24(29)19-9-10-19/h2-8,11-16,19,23H,9-10H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | SWXAMDATDJYAOP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |