C18H18ClNO5S — CID 7975012
[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate (PubChem CID 7975012) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7975012 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl] 2-chloro-5-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1ccc(Cl)c(C(=O)O[C@@H](C)C(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H18ClNO5S/c1-11-4-6-13(7-5-11)17(21)12(2)25-18(22)15-10-14(8-9-16(15)19)26(23,24)20-3/h4-10,12,20H,1-3H3/t12-/m0/s1 |
| InChIKey | XTNZIGFFYGVXFN-LBPRGKRZSA-N |
| XLogP | 2.98 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |