C10H10ClNOS2 — CID 82121362
3-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]propan-1-ol (PubChem CID 82121362) has the molecular formula C10H10ClNOS2 and a molecular weight of 259.78 g/mol. Its IUPAC name is 3-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]propan-1-ol.
| Compound Name | 3-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 82121362 |
| Molecular Formula | C10H10ClNOS2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 3-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]propan-1-ol |
| SMILES | OCCCc1nc(-c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C10H10ClNOS2/c11-9-4-3-8(15-9)7-6-14-10(12-7)2-1-5-13/h3-4,6,13H,1-2,5H2 |
| InChIKey | QVABXBOZIYUBBD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |