C10H9ClN2O4S2 — CID 118482423
[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]methanamine;oxalic acid (PubChem CID 118482423) has the molecular formula C10H9ClN2O4S2 and a molecular weight of 320.78 g/mol. Its IUPAC name is [4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]methanamine;oxalic acid.
| Compound Name | [4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]methanamine;oxalic acid |
|---|---|
| PubChem CID | 118482423 |
| Molecular Formula | C10H9ClN2O4S2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | [4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]methanamine;oxalic acid |
| SMILES | NCc1nc(-c2ccc(Cl)s2)cs1.O=C(O)C(=O)O |
| InChI | InChI=1S/C8H7ClN2S2.C2H2O4/c9-7-2-1-6(13-7)5-4-12-8(3-10)11-5;3-1(4)2(5)6/h1-2,4H,3,10H2;(H,3,4)(H,5,6) |
| InChIKey | IKLDNCQZDZKVQN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|