C11H10ClNOS2 — CID 94281595
4-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butan-2-one (PubChem CID 94281595) has the molecular formula C11H10ClNOS2 and a molecular weight of 271.79 g/mol. Its IUPAC name is 4-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butan-2-one.
| Compound Name | 4-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butan-2-one |
|---|---|
| PubChem CID | 94281595 |
| Molecular Formula | C11H10ClNOS2 |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 4-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]butan-2-one |
| SMILES | CC(=O)CCc1nc(-c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C11H10ClNOS2/c1-7(14)2-5-11-13-8(6-15-11)9-3-4-10(12)16-9/h3-4,6H,2,5H2,1H3 |
| InChIKey | ODEZMXYFBANOOS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |