C13H13BrN2S — CID 104928821
2-(2-bromophenyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole (PubChem CID 104928821) has the molecular formula C13H13BrN2S and a molecular weight of 309.23 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole.
| Compound Name | 2-(2-bromophenyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 104928821 |
| Molecular Formula | C13H13BrN2S |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 2-(2-bromophenyl)-4-[(2S)-pyrrolidin-2-yl]-1,3-thiazole |
| SMILES | Brc1ccccc1-c1nc([C@@H]2CCCN2)cs1 |
| InChI | InChI=1S/C13H13BrN2S/c14-10-5-2-1-4-9(10)13-16-12(8-17-13)11-6-3-7-15-11/h1-2,4-5,8,11,15H,3,6-7H2/t11-/m0/s1 |
| InChIKey | MMLMWPJRNJIZAO-NSHDSACASA-N |
| XLogP | 4.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |