C14H15BrN2S — CID 116888718
2-(2-bromophenyl)-4-piperidin-3-yl-1,3-thiazole (PubChem CID 116888718) has the molecular formula C14H15BrN2S and a molecular weight of 323.26 g/mol. Its IUPAC name is 2-(2-bromophenyl)-4-piperidin-3-yl-1,3-thiazole.
| Compound Name | 2-(2-bromophenyl)-4-piperidin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 116888718 |
| Molecular Formula | C14H15BrN2S |
| Molecular Weight | 323.26 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 2-(2-bromophenyl)-4-piperidin-3-yl-1,3-thiazole |
| SMILES | Brc1ccccc1-c1nc(C2CCCNC2)cs1 |
| InChI | InChI=1S/C14H15BrN2S/c15-12-6-2-1-5-11(12)14-17-13(9-18-14)10-4-3-7-16-8-10/h1-2,5-6,9-10,16H,3-4,7-8H2 |
| InChIKey | OHARVJTUCLNXQQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |