C13H12BrFN2S — CID 116888662
2-(5-bromo-2-fluorophenyl)-4-pyrrolidin-3-yl-1,3-thiazole (PubChem CID 116888662) has the molecular formula C13H12BrFN2S and a molecular weight of 327.22 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-4-pyrrolidin-3-yl-1,3-thiazole.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-4-pyrrolidin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 116888662 |
| Molecular Formula | C13H12BrFN2S |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-4-pyrrolidin-3-yl-1,3-thiazole |
| SMILES | Fc1ccc(Br)cc1-c1nc(C2CCNC2)cs1 |
| InChI | InChI=1S/C13H12BrFN2S/c14-9-1-2-11(15)10(5-9)13-17-12(7-18-13)8-3-4-16-6-8/h1-2,5,7-8,16H,3-4,6H2 |
| InChIKey | GZTDNZARSVDIES-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |