C9H5BrFNOS — CID 116889834
2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-ol (PubChem CID 116889834) has the molecular formula C9H5BrFNOS and a molecular weight of 274.11 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-ol.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 116889834 |
| Molecular Formula | C9H5BrFNOS |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 272.93 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1,3-thiazol-4-ol |
| SMILES | Oc1csc(-c2cc(Br)ccc2F)n1 |
| InChI | InChI=1S/C9H5BrFNOS/c10-5-1-2-7(11)6(3-5)9-12-8(13)4-14-9/h1-4,13H |
| InChIKey | CETBFGJXNIOYCL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |