C13H12ClFN2S — CID 114456904
2-(4-chloro-2-fluorophenyl)-4-pyrrolidin-2-yl-1,3-thiazole (PubChem CID 114456904) has the molecular formula C13H12ClFN2S and a molecular weight of 282.77 g/mol. Its IUPAC name is 2-(4-chloro-2-fluorophenyl)-4-pyrrolidin-2-yl-1,3-thiazole.
| Compound Name | 2-(4-chloro-2-fluorophenyl)-4-pyrrolidin-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 114456904 |
| Molecular Formula | C13H12ClFN2S |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-(4-chloro-2-fluorophenyl)-4-pyrrolidin-2-yl-1,3-thiazole |
| SMILES | Fc1cc(Cl)ccc1-c1nc(C2CCCN2)cs1 |
| InChI | InChI=1S/C13H12ClFN2S/c14-8-3-4-9(10(15)6-8)13-17-12(7-18-13)11-2-1-5-16-11/h3-4,6-7,11,16H,1-2,5H2 |
| InChIKey | AOADQPIOUMOHBH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |