C22H24N4OS — CID 18765781
N-[4-[[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethylamino]methyl]phenyl]acetamide (PubChem CID 18765781) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is N-[4-[[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethylamino]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethylamino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 18765781 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[4-[[2-[4-[[amino(thiophen-2-yl)methylidene]amino]phenyl]ethylamino]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(CNCCc2ccc(/N=C(\N)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C22H24N4OS/c1-16(27)25-19-10-6-18(7-11-19)15-24-13-12-17-4-8-20(9-5-17)26-22(23)21-3-2-14-28-21/h2-11,14,24H,12-13,15H2,1H3,(H2,23,26)(H,25,27) |
| InChIKey | LXIYSVIEXKHBEA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|