C19H20N4OS — CID 70204881
N'-[4-[2-[(2-oxo-1H-pyridin-4-yl)methylamino]ethyl]phenyl]thiophene-2-carboximidamide (PubChem CID 70204881) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N'-[4-[2-[(2-oxo-1H-pyridin-4-yl)methylamino]ethyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[2-[(2-oxo-1H-pyridin-4-yl)methylamino]ethyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70204881 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N'-[4-[2-[(2-oxo-1H-pyridin-4-yl)methylamino]ethyl]phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(CCNCc2cc[nH]c(=O)c2)cc1)c1cccs1 |
| InChI | InChI=1S/C19H20N4OS/c20-19(17-2-1-11-25-17)23-16-5-3-14(4-6-16)7-9-21-13-15-8-10-22-18(24)12-15/h1-6,8,10-12,21H,7,9,13H2,(H2,20,23)(H,22,24) |
| InChIKey | QBKYFIIWVWZVTK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 83.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|